T0901317 10mM * 1mL in DMSO
T0901317 is a potent, high affinity liver X receptor (LXR) agonist (EC50 ~ 50 nM, Kd values are 7 and 22 nM for LXR-?? and LXR-?? respectively).
| Trivial name | T0901317 10mM * 1mL in DMSO |
| Catalog Number | A12652-10mM-D |
| Alternative Name(s) | N-(2,2,2-Trifluoroethyl)-N-[4-[2,2,?2-trifluoro-1-hydroxy-1-(trifluoromethyl)ethyl]phe?nyl]benzenesulfonamide |
| Molecular Formula | C17H12F9NO3S |
| CAS# | 293754-55-9 |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)N(CC(F)(F)F)C2=CC=C(C=C2)C(C(F)(F)F)(C(F)(F)F)O |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/t0901317.html |
