SR3335 50mg
SR3335 is a selective ROR?? synthetic ligand, directly binds to ROR??, but not other RORs, and functions as a selective partial inverse agonist of ROR?? in cell-based assays.
Trivial name | SR3335 50mg |
Catalog Number | A15246-50 |
Alternative Name(s) | N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]thiophene-2-sulfonamide |
Molecular Formula | C₁₃H₉F₆NO₃S₂ |
CAS# | 293753-05-6 |
SMILES | C1=CSC(=C1)S(=O)(=O)NC2=CC=C(C=C2)C(C(F)(F)F)(C(F)(F)F)O |
Size | 50mg |
Supplier Page | http://www.adooq.com/sr3335.html |