Ciclopirox 50mg
Ciclopirox is currently being investigated as an alternative treatment to ketoconazole for seborrhoeic dermatitis as it suppresses growth of the yeast Malassezia furfur.It acts by inhibiting the membrane transfer system by interrupting the Na+ K+ ATPase.
| Trivial name | Ciclopirox 50mg |
| Catalog Number | A10213-50 |
| Alternative Name(s) | 6-cyclohexyl-1-hydroxy-4-methylpyridin-2(1H)-one |
| Molecular Formula | C12H17NO2 |
| CAS# | 29342-05-0 |
| SMILES | CC1=CC(=O)N(C(=C1)C2CCCCC2)O |
| Size | 50mg |
| Supplier Page | http://www.adooq.com/ciclopirox.html |