Ciclopirox 10mM * 1mL in DMSO
Ciclopirox is currently being investigated as an alternative treatment to ketoconazole for seborrhoeic dermatitis as it suppresses growth of the yeast Malassezia furfur.It acts by inhibiting the membrane transfer system by interrupting the Na+ K+ ATPase.
| Trivial name | Ciclopirox 10mM * 1mL in DMSO |
| Catalog Number | A10213-10mM-D |
| Alternative Name(s) | 6-cyclohexyl-1-hydroxy-4-methylpyridin-2(1H)-one |
| Molecular Formula | C12H17NO2 |
| CAS# | 29342-05-0 |
| SMILES | CC1=CC(=O)N(C(=C1)C2CCCCC2)O |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/ciclopirox.html |
