Ciclopirox 10mg
Ciclopirox is currently being investigated as an alternative treatment to ketoconazole for seborrhoeic dermatitis as it suppresses growth of the yeast Malassezia furfur.It acts by inhibiting the membrane transfer system by interrupting the Na+ K+ ATPase.
| Trivial name | Ciclopirox 10mg |
| Catalog Number | A10213-10 |
| Alternative Name(s) | 6-cyclohexyl-1-hydroxy-4-methylpyridin-2(1H)-one |
| Molecular Formula | C12H17NO2 |
| CAS# | 29342-05-0 |
| SMILES | CC1=CC(=O)N(C(=C1)C2CCCCC2)O |
| Size | 10mg |
| Supplier Page | http://www.adooq.com/ciclopirox.html |