Acedoben sodium | MedChemExpress (MCE)
Acedoben sodium is the sodium form of Acedoben. Acedoben is a biochemical reagent that can be used as a biological material or organic compound for life science related research[1].
| Trivial name | Acedoben sodium |
| Catalog Number | HY-B1250A |
| Research Area | Others |
| CAS# | 29305-16-6 |
| Purity | ≥98.0% |
| SMILES | O=C(O[Na])C1=CC=C(NC(C)=O)C=C1 |
| Size | 50 mg |
| Supplier Page | https://www.medchemexpress.com/acedoben-sodium.html |