SB-3CT 10mM * 1mL in DMSO
SB-3CT is an effective and selective gelatinase inhibitor with Ki of 13.9 nM and 600 nM for MMP-2 and MMP-9.
Trivial name | SB-3CT 10mM * 1mL in DMSO |
Catalog Number | A14253-10mM-D |
Alternative Name(s) | 2-[[(4-phenoxyphenyl)sulfonyl]methyl]-thiirane |
Molecular Formula | C15H14O3S2 |
CAS# | 292605-14-2 |
SMILES | C1C(S1)CS(=O)(=O)C2=CC=C(C=C2)OC3=CC=CC=C3 |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/sb-3ct.html |