ZHSI-1 | MedChemExpress (MCE)
ZHSI-1 is an EV71 (Enterovirus 71) inhibitor that inhibits EV71/CVA16 replication and virus-induced pyroptosis associated with viral pathogenesis. ZHSI-1 effectively prevents EV71 infection in neonatal and young mice in animal models. ZHSI-1 can be used to study viral infections such as hand, foot and mouth disease (HFMD)[1].
| Trivial name | ZHSI-1 |
| Catalog Number | HY-157082 |
| Research Area | Infection |
| CAS# | 2925912-67-8 |
| Purity | ≥98.00% |
| SMILES | CC(NC1=NC(NC2=CC=C3C(C=CC=N3)=C2)=CC(C)=N1)C |
| PubChem Chemical Structure ID | 169450779 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/zhsi-1.html |