MDM2/XIAP-IN-3 | MedChemExpress (MCE)
MDM2/XIAP-IN-3 (compound 3e) is a dual MDM2/XIAP inhibitor. MDM2/XIAP-IN-3 reduces MDM2 and XIAP protein levels and increases p53 expression, thereby inhibiting cancer cell growth and causing cell death[1].
| Trivial name | MDM2/XIAP-IN-3 |
| Catalog Number | HY-155571 |
| Research Area | Cancer |
| CAS# | 2925583-17-9 |
| Purity | ≥98.00% |
| SMILES | O=S(C1=CC2=C(NC(C3=CC=C(C(C(C)C)=O)C=C3)C4C2OCC4)C=C1)(NC5=CC=CC(C(C)=O)=C5)=O |
| PubChem Chemical Structure ID | 156155793 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/mdm2-xiap-in-3.html |