PT-179 | MedChemExpress (MCE)

PT-179 is an orthogonal Thalidomide (HY-14658) derivative that targets cereblon without causing off-target degradation effects. PT-179 is able to specifically bind CRBN, form a ternary complex with a target protein fused to a zinc finger (ZF) degron, and mediate the degradation of the tagged protein. For example, PT-179 binds to the ubiquitin ligase substrate receptor cereblon by forming a complex with SD40 and efficiently degrades proteins N- or C-terminally fused to SD40 or SD36 (DC50 for eGFP: 4.5 nM and 14.3 nM). PT-179 can be used to develop compact protein degradation tagging platforms[1].

Trivial name PT-179
Catalog Number HY-160695
Research Area Cancer
CAS# 2924858-25-1
Purity 99.9%
SMILES O=C1C2=CC=C(N3CCOCC3)C=C2C(N1C4C(NC(CC4)=O)=O)=O
Size 10 mg
Supplier Page https://www.medchemexpress.com/pt-179.html