GSK_WRN3 | MedChemExpress (MCE)
GSK_WRN3 is a selective inhibitor of WRN protease (IC50 = 8.6 μM). GSK_WRN3 displays a high degree of selectivity by forming a covalent binding to the Cys727 residue of the WRN protein. GSK_WRN3 reduces growth support for MSI tumor cells by inhibiting WRN protease activity, resulting in increased DNA double-strand breaks and cell growth inhibition[1].
| Trivial name | GSK_WRN3 |
| Catalog Number | HY-162471 |
| Research Area | Cancer |
| CAS# | 2923009-50-9 |
| Purity | ≥98.0% |
| SMILES | OC1=C(NC(C(C(N[C@H]2CS(C=C2)(=O)=O)=O)=C1)=O)C3CCCCC3 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/gsk-wrn3.html |