MC-VC-PABC-C6-alpha-Amanitin | MedChemExpress (MCE)
MC-VC-PABC-C6-alpha-Amanitin is an antibody agent conjugate consisting of an anticancer toxin alpha-Amanitin (HY-19610) and a monoclonal antibody MC-VC-PABC-C6. Among them, alpha-Amanitin is a potent inhibitor of RNA polymerase IIα. MC-VC-PABC-C6-alpha-Amanitin accurately targets HER2 receptors, specifically recognizes HER2-positive tumor cells. It is widely used in breast cancer and gastric cancer research[1].
| Trivial name | MC-VC-PABC-C6-alpha-Amanitin |
| Catalog Number | HY-131089 |
| Research Area | Cancer |
| CAS# | 2922514-69-8 |
| Purity | ≥98.00% |
| SMILES | O=S(C[C@@](NC(CNC([C@@]([C@@H](C)CC)([H])N1)=O)=O)([H])C(N[C@@](C(N(C[C@H](O)C2)[C@]2([H])C3=O)=O)([H])CC(N)=O)=O)C4=C(C[C@](C(NCC1=O)=O)([H])NC([C@](N3)([H])[C@@H](C)[C@@H](O)CO)=O)C5=CC=C(OCCCCCCNC(OCC6=CC=C(NC([C@H](CCCNC(N)=O)NC([C@H](C(C)C)NC(CCCCCN7C(C=CC7=O)=O)=O)=O)=O)C=C6)=O)C=C5N4 |
| PubChem Chemical Structure ID | 146673160 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/mc-vc-pabc-c6-alpha-amanitin.html |