L-Kynurenine
L-Kynurenine ((S)-Kynurenine) is a aryl hydrocarbon receptor agonist. L-Kynurenine is a metabolite of the amino acid L-tryptophan used in the production of niacin and a central compound of the tryptophan metabolism pathway.
| Trivial name | (S)-Kynurenine |
| Catalog Number | S5839 |
| Molecular Formula | C28H25N3O6S2 |
| CAS# | 2922-83-0 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | COC1=CC=CC=C1C(N[S](=O)(=O)C2=CC3=C(NC(=O)C=C3)C=C2)C(=O)N(CC4=CC=CO4)CC5=CC=CS5 |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/l-kynurenine.html |
| Additional Information | https://file.selleck.cn/downloads/struct/l-kynurenine-chemical-structure-s5839.gif |