CCI-006
CCI-006 is a novel inhibitor of MLL-rearranged and CALM-AF10 translocated leukemias, inhibiting mitochondrial respiration and inducing mitochondrial membrane depolarization and apoptosis in a subset (7/11, 64%) of MLL-rearranged leukemia cell lines within a few hours of treatment.
| Trivial name | / |
| Catalog Number | CSN25545 |
| Alternative Name(s) | / |
| Research Area | Cancer |
| Molecular Formula | C15H12N2O5S |
| CAS# | 292053-42-0 |
| Purity | ≥99% |
| SMILES | O=C(OC)/C(C#N)=C/C1=CC=C(C2=CC=C(S(=O)(N)=O)C=C2)O1 |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/methyl-2-cyano-3-(5-(4-sulfamoylphenyl)furan-2-yl)acrylate.html |