Guanfacine HCl
Guanfacine HCl is a centrally acting antihypertensive with α2-adrenoceptor agonist with Kd value of 31 nM for α2A-adrenoceptor while displaying 60-fold selectivity over α2B-adrenoceptors, causing a decrease in heart rate and peripheral vascular resistance.
| Trivial name | Guanfacine |
| Catalog Number | CSN13464 |
| Alternative Name(s) | Guanfacine |
| Research Area | Cardiovascular Disease |
| Molecular Formula | C9H10Cl3N3O |
| CAS# | 29110-48-3 |
| Purity | ≥99% |
| SMILES | O=C(NC(N)=N)CC1=C(Cl)C=CC=C1Cl.[H]Cl |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/guanfacine-hcl.html |