Hymeglusin
L-659,699, also known as hymeglusin, is a fungal β-lactone antibiotic that inhibits HMG-CoA synthase (IC50 = 0.12 μM) by covalently modifying the active Cys129 residue of the enzyme.
| Trivial name | Antibiotic 1233A;F-244;L-659699 |
| Catalog Number | CSN25355 |
| Alternative Name(s) | Antibiotic 1233A;F-244;L-659699 |
| Research Area | Infection |
| Molecular Formula | C18H28O5 |
| CAS# | 29066-42-0 |
| Purity | ≥98% |
| SMILES | O=C(O)/C=C(C)/C=C(C)/C[C@H](C)CCCC[C@H]([C@H]1CO)OC1=O |
| Size | 1mg |
| Supplier Page | https://www.csnpharm.com/products/hymeglusin.html |