LSD1-IN-27 | MedChemExpress (MCE)
LSD1-IN-27 (Compound 5ac) is a LSD1 inhibitor (IC50: 13 nM). LSD1-IN-27 inhibits the stemness and migration of gastric cancer cells. LSD1-IN-27 also reduces the expression of PD-L1 in BGC-823 and MFC cells. LSD1-IN-27 can enhance T cell immune response in gastric cancer[1].
| Trivial name | LSD1-IN-27 |
| Catalog Number | HY-155115 |
| Research Area | Cancer |
| CAS# | 2904571-94-2 |
| Purity | ≥98.00% |
| SMILES | CC1=CC=C2C(C(NC3=CC=C(N(C)C)C=C3)=C4C(C(C)=C(C)C=C4)=N2)=C1 |
| PubChem Chemical Structure ID | 168510569 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/lsd1-in-27.html |