BMS 299897 100mg
BMS 299897 is an orally active, potent ??-secretase inhibitor (IC50 = 12 nM). Inhibits A??40 and A??42 formation in vitro (IC50 values are 7.4 and 7.9 nM respectively) and reduces A?? in the brain, plasma and cerebrospinal fluid in vivo.
| Trivial name | BMS 299897 100mg |
| Catalog Number | A12444-100 |
| Alternative Name(s) | 2-[(1R)-1-[[(4-Chlorophenyl)sulfony?l](2,5-difluorophenyl)amino]ethyl-5-fluorobenzeneb?utanoic acid |
| Molecular Formula | C24H21ClF3NO4S |
| CAS# | 290315-45-6 |
| SMILES | C[C@H](C1=C(C=C(C=C1)F)CCCC(=O)O)N(C2=C(C=CC(=C2)F)F)S(=O)(=O)C3=CC=C(C=C3)Cl |
| Size | 100mg |
| Supplier Page | http://www.adooq.com/bms-299897.html |
