Netupitant
Inhibitors
| Trivial name | NULL |
| Catalog Number | CS-O-06331 |
| Alternative Name(s) | 2-[3,5-Bis(trifluoromethyl)phenyl]-N,2-dimethyl-N-[4-(2-methylphenyl)-6-(4-methyl-1-piperazinyl)-3-pyridinyl]propanamide |
| Research Area | Netupitant is a potent and selective neurokinin-1 receptor (NK1) receptor antagonist. It is achiral and orally active. |
| Molecular Formula | C30H32F6N4O |
| CAS# | 290297-26-6 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CN(C1=CN=C(N2CCN(C)CC2)C=C1C(C=CC=C3)=C3C)C(C(C)(C4=CC(C(F)(F)F)=CC(C(F)(F)F)=C4)C)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO06331.html |
| Additional Information | NULL |