Netupitant
neurokinin 1 (NK1) receptor antagonist Neuroscience|Substance P/NK1 Receptor
| Catalog Number | B6142-50 |
| Research Area | Neuroscience|Substance P/NK1 Receptor |
| Molecular Formula | C30H32F6N4O |
| CAS# | 290297-26-6 |
| Purity | 98% |
| SMILES | CC1=CC=CC=C1C2=CC(N3CCN(CC3)C)=NC=C2N(C(C(C)(C4=CC(C(F)(F)F)=CC(C(F)(F)F)=C4)C)=O)C |
| Size | 50mg |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B6142 |
