CB 300919 10mg
CB 300919 is a potential therapy for ovarian cancer. Preclinical data showed that this quinazoline-based compound CB 300919 has a continuous exposure (96 h) growth inhibition IC50 value of 2 nM in human CH1 ovarian tumor xenograft
| Trivial name | CB 300919 10mg |
| Catalog Number | A11359-10 |
| Alternative Name(s) | 4-[[[7-Chloro-3,4-dihydro-3-methyl-2-[(4-methyl-1-piperazinyl)methyl]-4-oxo-6-quinazolinyl]methyl]-2-propyn-1-ylamino]-N-(3-pyridinylmethyl)benzamide |
| Molecular Formula | C32H34ClN7O2 |
| CAS# | 289715-28-2 |
| SMILES | CN1CCN(CC1)CC2=NC3=CC(=C(C=C3C(=O)N2C)CN(CC#C)C4=CC=C(C=C4)C(=O)NCC5=CN=CC=C5)Cl |
| Size | 10mg |
| Supplier Page | http://www.adooq.com/cb-300919.html |
