Senicapoc
Senicapoc is a potent and selective Gardos channel blocker and blocks Ca(2+)-induced rubidium flux from human RBCs/ inhibited RBC dehydration with IC50s of 11 nM/30 nM, respectively.
| Trivial name | ICA-17043 |
| Catalog Number | CSN12384 |
| Alternative Name(s) | ICA-17043 |
| Research Area | / |
| Molecular Formula | C20H15F2NO |
| CAS# | 289656-45-7 |
| Purity | ≥99% |
| SMILES | O=C(N)C(C1=CC=C(F)C=C1)(C2=CC=C(F)C=C2)C3=CC=CC=C3 |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/senicapoc.html |
