Exatecan-amide-bicyclo[1.1.1]pentan-1-ylmethanol | MedChemExpress (MCE)
Exatecan-amide-bicyclo[1.1.1]pentan-1-ylmethanol (compound 45) is a camptothecin compound that can inhibit cell proliferation, with an IC50 of 2.92 ng/mL for MDA‑MB‑468 cells. Exatecan-amide-bicyclo[1.1.1]pentan-1-ylmethanol can be used for the research of cancer[1].
| Trivial name | Exatecan-amide-bicyclo[1.1.1]pentan-1-ylmethanol |
| Catalog Number | HY-160598 |
| Research Area | Cancer |
| CAS# | 2891774-71-1 |
| Purity | ≥98.0% |
| SMILES | O=C1N2C(C3=NC4=CC(F)=C(C)C(CC5)=C4C([C@H]5NC(C67CC(C6)(C7)CO)=O)=C3C2)=CC([C@](O)8CC)=C1COC8=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/exatecan-amide-bicyclo-1-1-1-pentan-1-ylmethanol.html |