Lithospermic Acid
Lithospermic acid is a natural product isolated and purified from the roots of Lithospermum ruderale with anti-HIV, anti-gonadotrophic and anti-thyroidal effects, and is a cardiotonic agent.
| Trivial name | / |
| Catalog Number | CSN19879 |
| Alternative Name(s) | / |
| Research Area | Cardiovascular Disease|Infection |
| Molecular Formula | C27H22O12 |
| CAS# | 28831-65-4 |
| Purity | ≥99% |
| SMILES | O=C([C@@H]1[C@@H](C2=CC=C(O)C(O)=C2)OC3=C(O)C=CC(/C=C/C(O[C@@H](C(O)=O)CC4=CC=C(O)C(O)=C4)=O)=C13)O |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/lithospermic-acid.html |