KRAS G12D modulator-1 | MedChemExpress (MCE)
KRAS G12D modulator-1 (compound 6) is a potent KRAS G12D modulator with IC50 values of 1-10 μM for NEA-G12D, PPI-G12D, and p ERK-AGS, respectively. KRAS G12D modulator-1 can be used in research of cancer[1].
| Trivial name | KRAS G12D modulator-1 |
| Catalog Number | HY-153555 |
| Research Area | Cancer |
| CAS# | 2883034-05-5 |
| Purity | ≥98.00% |
| SMILES | OC1=CC(C=CC=C2)=C2C(N3CC4=NC(OC[C@@]56N(CCC6)C[C@@H](C5)F)=NC(N7C[C@@H](C[C@H](C7)O)O)=C4CC3)=C1 |
| PubChem Chemical Structure ID | 168355659 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/kras-g12d-modulator-1.html |