alpha-Asarone
alpha-Asarone is a naturally occuring inhibitor of both HMG-CoA reductase (IC50 = 3 mM) and certain isoforms of the cytochrome P450 superfamily of enzymes (IC50 = 55.2 and 65.2 μg/ml for CYP2D6 and CYP3A4, respectively), with neuroprotective, anti-oxidative, anticonvulsive and cognitive enhancing action.
| Trivial name | α-Asarone |
| Catalog Number | CSN11493 |
| Alternative Name(s) | α-Asarone |
| Research Area | Neurological Disease |
| Molecular Formula | C12H16O3 |
| CAS# | 2883-98-9 |
| Purity | ≥99% |
| SMILES | C/C=C/C1=C(OC)C=C(OC)C(OC)=C1 |
| Size | 1g |
| Supplier Page | https://www.csnpharm.com/products/alpha-asarone.html |
