IBMX
IBMX is a competitive nonselective PDEs inhibitor and a nonselective adenosine receptor antagonist, with IC50 of 2-50 μM but does not inhibit PDE8 or PDE9.
| Trivial name | 3-Isobutyl-1-Methylxanthine; IMX; Isobutylmethylxanthine; Methylisobutylxanthine |
| Catalog Number | CSN19387 |
| Alternative Name(s) | 3-Isobutyl-1-Methylxanthine; IMX; Isobutylmethylxanthine; Methylisobutylxanthine |
| Research Area | Immunology/Inflammation |
| Molecular Formula | C10H14N4O2 |
| CAS# | 28822-58-4 |
| Purity | ≥99% |
| SMILES | O=C(N1C)N(CC(C)C)C2=C(NC=N2)C1=O |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/ibmx.html |