SB-408124
SB-408124 is a non-peptide antagonist for OX1 receptor with Ki of 57 nM and 27 nM in both whole cell and membrane, respectively, and exhibits 50-fold selectivity over OX2 receptor.
| Trivial name | / |
| Catalog Number | CSN16521 |
| Alternative Name(s) | / |
| Research Area | Neurological Disease |
| Molecular Formula | C19H18F2N4O |
| CAS# | 288150-92-5 |
| Purity | ≥98% |
| SMILES | O=C(NC1=CC=C(N(C)C)C=C1)NC2=CC(C)=NC3=C(F)C=C(F)C=C23 |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/sb-408124.html |