MCT1-IN-3 | MedChemExpress (MCE)
MCT1-IN-3 is a monocarboxylate transporter 1 (MCT1) inhibitor with an IC50 value of 81.0 nM. MCT1-IN-3 has also significant inhibitivity against the multidrug transporter ABCB1. MCT1-IN-3 can be used for the research of cancer[1].
| Trivial name | MCT1-IN-3 |
| Catalog Number | HY-148574 |
| Research Area | Cancer |
| CAS# | 2878360-80-4 |
| Purity | ≥98.00% |
| SMILES | COC(/C(C#N)=C/C1=CN(C2=CC=CC=C12)CC(NC3=CC=C(C=C3)OC)=O)=O |
| PubChem Chemical Structure ID | 166642635 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/mct1-in-3.html |