Oxcarbazepine
It is a anticholinergic anticonvulsant and mood stabilizing drug, used primarily in the treatment of epilepsy. It has a role as an anticonvulsant and a drug allergen.
| Catalog Number | API28721075 |
| Alternative Name(s) | Trileptal Oxcarbamazepine Oxacarbazepine |
| Research Area | Other APIs |
| Molecular Formula | C15H12N2O2 |
| CAS# | 28721-07-5 |
| SMILES | C1C2=CC=CC=C2N(C3=CC=CC=C3C1=O)C(=O)N |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/oxcarbazepine-item-5920.html |