Oxcarbazepine
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-30723 |
| Alternative Name(s) | 10,11-Dihydro-10-oxo-5h-dibenz[b,f]azepine5H-dibenzo[b,f]azepine-5carboxamide. |
| Research Area | It is an anticonvulsant and mood-stabilizing drug, used primarily in the treatment of epilepsy. |
| Molecular Formula | C15H12N2O2 |
| CAS# | 28721-07-05 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | NC(N(C(C=CC=C1)=C1C2)C3=CC=CC=C3C2=O)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO30723.html |
| Additional Information | NULL |