Ir-CA | MedChemExpress (MCE)
Ir-CA is an antitumor agent. Ir-CA can accumulate in mitochondria and induces mitochondria dysfunction. Ir-CA induces apoptosis and autophagy. Ir-CA initiates mitophagy and cell cycle arrest to kill Cisplatin (HY-17394)-resistant A549R cells. Ir-CA can effectively inhibit metastasis by inhibiting MMP-2/MMP-9[1].
| Trivial name | Ir-CA |
| Catalog Number | HY-162344 |
| Research Area | Cancer |
| CAS# | 2870682-93-0 |
| Purity | ≥98.0% |
| SMILES | CC1=CC2=[N](C=C1)[Ir+3]34([C-]5=C(C=CC=C5)C6=[N]3C=CC=C6)([C-]7=C(C=CC=C7)C8=[N]4C=CC=C8)[N]9=CC=C(CNC(/C=C/C%10=CC=CC=C%10)=O)C=C29.[F-][P+5]([F-])([F-])([F-])([F-])[F-] |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/ir-ca.html |