D-Arabinose
Carbohydrates
| Trivial name | NULL |
| Catalog Number | CS-O-11622 |
| Alternative Name(s) | D-Arabinopyranose |
| Research Area | An inhibitor of the enzyme glucose dehydrogenase. |
| Molecular Formula | C5H10O5 |
| CAS# | 28697-53-2 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O[C@H]([C@@H](CO1)O)[C@@H](C1O)O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO11622.html |
| Additional Information | NULL |