Fesoterodine fumarate 10mM * 1mL in DMSO
Fesoterodine fumarate is a medicine which is used in urinary urgency, reducing the frequency of passing urine and urge urinary incontinence
| Trivial name | Fesoterodine fumarate 10mM * 1mL in DMSO |
| Catalog Number | A10386-10mM-D |
| Alternative Name(s) | 2-[(1R)-3-[Bis(1-methylethyl)amino]-1-phenylpropyl]-4-(hydroxymethyl)phenyl 2-methylpropanoate fumarate |
| Molecular Formula | C26H37NO3.C4H4O4 |
| CAS# | 286930-03-8 |
| SMILES | CC(C)C(=O)OC1=C(C=C(C=C1)CO)[C@H](CCN(C(C)C)C(C)C)C2=CC=CC=C2.C(=C/C(=O)O)C(=O)O |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/fesoterodine-fumarate-toviaz.html |