JQKD82 dihydrochloride | MedChemExpress (MCE)
JQKD82 (JADA82) dihydrochloride is a cell-permeable and selective KDM5 inhibitor. JQKD82 dihydrochloride increases H3K4me3 and can be used for the research of multiple myeloma[1].
| Trivial name | JQKD82 dihydrochloride |
| Catalog Number | HY-138691B |
| Alternative Name(s) | JADA82 dihydrochloride; PCK82 dihydrochloride |
| Research Area | Cancer |
| CAS# | 2863635-05-4 |
| Purity | ≥98.00% |
| SMILES | O=C(C1=CC(CNCC(N(CCN(C)C)CC)=O)=NC=C1)OC2=CC=C(C=C2OC(C)C)OC(C)C.Cl.Cl |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/jqkd82-dihydrochloride.html |