Sodium Estrone D4 Sulfate
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-06594 |
| Alternative Name(s) | Sodium Estrone-D4 Sulfate;Estrone-3-sulphate D4;estra-1,3,5(10)-trien-17-one, 3-(sulfooxy)-d4, sodium salt;Estrone-D4 Sulfate sodium. |
| Research Area | Labeled Estrone, intended for use as an internal standard for the quantification of Estrone by GC- or LC-mass spectrometry. |
| Molecular Formula | C18H17D4NaO5S |
| CAS# | 285979-80-8 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C[C@@]1(C2=O)[C@](CC2([2H])[2H])([H])[C@@](CCC3=C4[2H])([H])[C@](C3=CC([2H])=C4O[S](=O)([O-])=O)([H])CC1.[Na+] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO06594.html |
| Additional Information | NULL |