BM567 | MedChemExpress (MCE)
BM567 is a sulfonylurea compound (compound 1), which exhibits antithrombogenic efficacy as thromboxane A2 receptor (TXR) antagonists and thromboxane A2 synthase (TXS) inhibitors, with IC50s of 1.1 and 12 nM, respectively[1].
| Trivial name | BM567 |
| Catalog Number | HY-124150 |
| Research Area | Cardiovascular Disease |
| CAS# | 284464-77-3 |
| Purity | ≥98.0% |
| SMILES | O=S(C1=CC([N+]([O-])=O)=CC=C1NC2CCCCC2)(NC(NCCCCC)=O)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/bm567.html |