NPS-2143 50mg
NPS-2143 is a selective Ca2+-sensing receptor antagonist, shown to block increases in cytoplasmic Ca2+ concentrations elicited by human Ca2+ receptors expressed in HEK293 cells with an IC50 of 43 nM.
| Trivial name | NPS-2143 50mg |
| Catalog Number | A11140-50 |
| Alternative Name(s) | 2-Chloro-6-[(2R)-3-[[1,1-dimethyl-2-(2-naphthalenyl)ethyl]amino-2-hydroxypropoxy]benzonitrile |
| Molecular Formula | C24H25ClN2O2 |
| CAS# | 284035-33-2 |
| SMILES | CC(C)(CC1=CC2=CC=CC=C2C=C1)NC[C@H](COC3=C(C(=CC=C3)Cl)C#N)O |
| Size | 50mg |
| Supplier Page | http://www.adooq.com/nps-2143-sb-262470.html |
