(+)-Tramadol D6
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-14404 |
| Alternative Name(s) | (1R,2R)-2-{[bis(D3)methylamino]methyl}-1-(3- methoxyphenyl)cyclohexan-1-ol |
| Research Area | Labeled Tramadol , intended for use as an internal standard for the quantification of Tramadol by GC- or LC-mass spectrometry. |
| Molecular Formula | C16H19D6NO2 |
| CAS# | 284025-75-8 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O[C@@](CCCC1)(C2=CC(OC)=CC=C2)[C@H]1CN(C([2H])([2H])[2H])C([2H])([2H])[2H] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO14404.html |
| Additional Information | NULL |