(2,4,6-Trichloro-3-hydroxy-5-methoxyphenyl)methyl β-D-glucopyranoside | MedChemExpress (MCE)
(2,4,6-Trichloro-3-hydroxy-5-methoxyphenyl)methyl β-D-glucopyranoside (Compound 1) is a chlorophenyl glycoside that can be isolated from Lilium regale. Lilium regale is used for research of lung ailments[1].
| Trivial name | (2,4,6-Trichloro-3-hydroxy-5-methoxyphenyl)methyl β-D-glucopyranoside |
| Catalog Number | HY-N12155 |
| Research Area | Inflammation/Immunology; Cancer |
| CAS# | 2839363-14-1 |
| Purity | ≥98.00% |
| SMILES | OC[C@H]([C@H]([C@@H]([C@H]1O)O)O)O[C@H]1OCC2=C(C(OC)=C(C(O)=C2Cl)Cl)Cl |
| PubChem Chemical Structure ID | 165430713 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/2-4-6-trichloro-3-hydroxy-5-methoxyphenyl-methyl-β-d-glucopyranoside.html |