MB076 | MedChemExpress (MCE)
MB076 is a novel heterocyclic triazole with improved plasma stability. MB076 inhibits seven different Class C Acinetobacter-derived cephalosporinases (ADCs) β-lactamase variants with Ki values ＜ 1 μM. MB076 acts synergistically in combination with multiple cephalosporins to restore pBCSK(−) susceptibility[1].
| Trivial name | MB076 |
| Catalog Number | HY-155011 |
| Research Area | Others |
| CAS# | 2832966-95-5 |
| Purity | ≥98.00% |
| SMILES | NC1=NN=C(SCC(N[C@H](B(O)O)CN2C=C(C(O)=O)N=N2)=O)S1 |
| PubChem Chemical Structure ID | 168451748 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/mb076.html |