Elenestinib phosphate
Elenestinib phosphate(BLU-263 phosphate) is a potent and orally active inhibitor of tyrosine kinase that exhibits potent inhibition of c-KIT (D816V) mutation. BLU-263 phosphate has the potential for its use in the research of systemic mastocytosis (SM).
| Trivial name | BLU-263 phosphate |
| Catalog Number | E1662 |
| Molecular Formula | C24H19F2N5O5 |
| CAS# | 2832013-93-9 |
| SMILES | CC(C)N(C(=O)N1N=NN(C1=O)C2=C(F)C=CC=C2F)C3=CC=C(C=C3OC4=CC=CC=C4)C(O)=O |
| Size | 100mg |
| Supplier Page | http://www.selleckchem.com/products/elenestinib-phosphate.html |
| Additional Information | https://file.selleck.cn/downloads/struct/E1662-Elenestinib-phosphate-chemical-structure.png |
