LC-MB12 | MedChemExpress (MCE)
LC-MB12 is an orally active PROTAC compound targets FGFR2 degradation with a DC50 of 11.8 nM. LC-MB12 contains BGJ398 (a FGFR2 inhibitor), PROTAC linker and CRBN.LC-MB12 inhibits FGFR2 signaling in gastric cancer cells and has anti-tumor activity[1].
| Trivial name | LC-MB12 |
| Catalog Number | HY-149843 |
| Research Area | Cancer |
| CAS# | 2828438-38-4 |
| Purity | 99.23% |
| SMILES | O=C(N(C)C1=CC(NC2=CC=C(N3CCN(CC3)C(C4CCN(CC4)C5=CC=C6C(N(C7C(NC(CC7)=O)=O)C(C6=C5)=O)=O)=O)C=C2)=NC=N1)NC8=C(Cl)C(OC)=CC(OC)=C8Cl |
| PubChem Chemical Structure ID | 168432120 |
| Size | 25 mg |
| Supplier Page | https://www.medchemexpress.com/lc-mb12.html |