CVN293 | MedChemExpress (MCE)
CVN293 is a selective and brain permeable potassium ion (K+) channel KCNK13 inhibtor with IC50s of 41 nM and 28 nM for hKCNK13 and mKCNK13, respectively. CVN293 potently inhibits the NLRP3-inflammasome mediated production of the proinflammatory cytokine IL-1β in microglia[1].
| Trivial name | CVN293 |
| Catalog Number | HY-158155 |
| Research Area | Inflammation/Immunology |
| CAS# | 2815296-08-1 |
| Purity | ≥98.0% |
| SMILES | NC1=NON=C1C2=NC3=CC=CC(F)=C3N2CC4=NN=CC=C4 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/cvn293.html |