KH-4-43 | MedChemExpress (MCE)
KH-4-43 is an inhibitor of E3 CRL4. KH-4-43 inhibits E3 CRL4’s core ligase complex and exhibits anticancer activity. KH-4-43 has a binding Kd to E3 ROC1-CUL4A CTD or the highly related ROC1-CUL1 CTD at 83 nM or 9.4 μM, respectively[1].
| Trivial name | KH-4-43 |
| Catalog Number | HY-148602 |
| Research Area | Cancer |
| CAS# | 2813310-07-3 |
| Purity | 99.99% |
| SMILES | O=C1C2=CC=C(C(O)=C2OC(C(F)(F)F)=C1C3=CN(C4=CC=C(C=C4)Cl)N=C3)O |
| PubChem Chemical Structure ID | 164603779 |
| Size | 10 mg |
| Supplier Page | https://www.medchemexpress.com/kh-4-43.html |