Etidronate (Didronel) 1g
Etidronic acid is a bisphosphonate used to strengthen bone, treat osteoporosis, and treat Paget’s disease of bone. An etidronate is a salt of etidronic acid, abbeviated MnHEDP. Etidronate, unlike other bisphosphonates, also prevents bone calcification.
| Trivial name | Etidronate (Didronel) 1g |
| Catalog Number | A11684-1000 |
| Alternative Name(s) | (1-hydroxyethan-1,1-diyl)bis(phosphonic acid) |
| Molecular Formula | C2H8O7P2 |
| CAS# | 2809-21-4 |
| SMILES | CC(O)(P(=O)(O)O)P(=O)(O)O |
| Size | 1000mg |
| Supplier Page | http://www.adooq.com/etidronate-didronel.html |