SB 216763 10mM * 1mL in DMSO
SB 216763 is a potent and selective cell permeable ATP-competitive inhibitor of GSK3?? with an IC50 value of 34 nM (similar potency for GSK3??).
Trivial name | SB 216763 10mM * 1mL in DMSO |
Catalog Number | A10825-10mM-D |
Alternative Name(s) | 3-(2,4-Dichlorophenyl)-4-(1-methyl-1H-indol-3-yl)-1H-pyrrole-2,5-dione |
Molecular Formula | C19H12Cl2N2O2 |
CAS# | 280744-09-4 |
SMILES | CN1C=C(C2=CC=CC=C21)C3=C(C(=O)NC3=O)C4=C(C=C(C=C4)Cl)Cl |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/sb-216763.html |