Uridine 5′-diphosphoglucose disodium salt
Uridine 5′-diphosphoglucose disodium salt (UDP-D-Glucose disodium salt) is the precursor of glucose-containing oligosaccharides, polysaccharides, glycoproteins, and glycolipids in animal tissues and in some microorganisms. Uridine-5′-diphosphoglucose is an agonist of the P2Y14 receptor, a neuroimmune system GPCR.
| Trivial name | UDP-D-Glucose disodium salt |
| Catalog Number | CSN27554 |
| Alternative Name(s) | UDP-D-Glucose disodium salt |
| Research Area | / |
| Molecular Formula | C15H22N2Na2O17P2 |
| CAS# | 28053-08-9 |
| Purity | ≥97% |
| SMILES | O[C@@H]1[C@@H](CO)O[C@@H]([C@@H]([C@H]1O)O)OP([O-])(OP([O-])(OC[C@H]2O[C@H]([C@@H]([C@@H]2O)O)N3C=CC(NC3=O)=O)=O)=O.[Na+].[Na+] |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/uridine-5′-diphosphoglucose-disodium-salt.html |