Bromophenol red (sultone form) | MedChemExpress (MCE)
Bromophenol red (sultone form) is a chemical indicator. It has been shown to bind to lysozyme and inhibit its activity against the bacterial cell wall, but not the polysaccharide component of peptidoglycan.
| Trivial name | Bromophenol red (sultone form) |
| Catalog Number | HY-D0011A |
| CAS# | 2800-80-8 |
| Purity | ≥98.0% |
| SMILES | O=S1(OC(C2=CC=C(C(Br)=C2)O)(C3=C1C=CC=C3)C4=CC=C(C(Br)=C4)O)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/bromophenol-red-sultone-form.html |