STR-V-53 | MedChemExpress (MCE)
STR-V-53 is an HDAC inhibitor (IC50 in nM).STR-V-53 increases histone acetylation in tumor cells by inhibiting the activity of these enzymes, which in turn regulates gene expression.STR-V-53 inhibits tumor growth, and induces apoptosis[1].
| Trivial name | STR-V-53 |
| Catalog Number | HY-161412 |
| Research Area | Cancer |
| CAS# | 2798954-66-0 |
| Purity | ≥98.0% |
| SMILES | OC[C@H]1O[C@H](OC2=CC=C(C3=CN(CCCCCCC(NO)=O)N=N3)C=C2)[C@H](O)[C@@H](O)[C@@H]1O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/str-v-53.html |